Want to see correct answers?
Login or join for free!
  Chemistry Worksheets
Looking for Chemistry worksheets?
Check out our pre-made Chemistry worksheets!
Share/Like This Page
Filter By Grade

You are browsing College questions. View questions in All Grades.

Grade 6 Grade 7 Grade 8 Grade 9 Grade 10 Grade 11 Grade 12 College Continuing Education

College Organic Chemistry Questions

You can create printable tests and worksheets from these College Organic Chemistry questions! Select one or more questions using the checkboxes above each question. Then click the add selected questions to a test button before moving to another page.

Previous Page 1 of 3 Next
College Organic Chemistry
The branch of science that applies to substances that contain carbon is called:
  1. inorganic chemistry
  2. organic chemistry
  3. matter chemistry
  4. structural chemistry
College Organic Chemistry
The branch of science that applies to substances that contain carbon is:
  1. inorganic chemistry
  2. organic chemistry
  3. matter chemistry
  4. structural chemistry
College Organic Chemistry
College Organic Chemistry
What is the difference between an inorganic and organic molecule?
  1. inorganic molecules are made from carbon
  2. inorganic molecules are made from hydrogen
  3. organic molecules are made from hydrogen
  4. organic molecules form strong covalent bonds
  5. inorganic molecules form strong covalent bonds
College Organic Chemistry
Which of the following statements is true for all organic compounds?
  1. it has hydroxyl functional groups
  2. it has carboxyl functional groups
  3. it is carbon-based
  4. it has carbonyl functional groups
  5. it contains oxygen atoms
College Organic Chemistry
An organic molecule having only hydrogen and carbon atoms is called a(n)
  1. protein
  2. hydrocarbon
  3. carbohydrate
  4. none of the above
College Organic Chemistry
Phospholipids are composed of which of the following chemical components?
  1. Glycerol, a carboxyl group, glycerol, amine, and amino acid
  2. A carboxyl group, glycerol, amino acid, and one fatty acid
  3. Glycerol, a phosphate group, two fatty acids, and a polar molecule
  4. None of the above
College Organic Chemistry
Given the organic compound below, how would this be named?
Formula - Cis Butene
  1. cis-2-butene
  2. trans-1-butene
  3. cis-1-butene
  4. trans-2-butene
College Organic Chemistry
Which of the following represents a correct name for the compound shown in the diagram?
Formula - 1,2,4-Tribromobenzene
  1. 1,2,3-tribromobenzene
  2. 1,2,4-tribromobenzene
  3. 2,3,6-tribromobenzene
  4. None of the above
College Organic Chemistry
The following polymer could be the result of which of the following processes?
Formula - Polystyrene
  1. Addition polymerization
  2. Substitution polymerization
  3. Condensation polymerization
  4. None of the above
College Organic Chemistry
The notation 18:3 Delta 9, 12,15 represents:
  1. CH3-(CH2)7-(CH=CH-CH2)3-COOH
  2. CH3-(CH2)7-CH=CH-(CH2)7-COOH
  3. Ch3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7-COOH
  4. CH3-(CH2-CH=CH)3-(CH2)7-COOH
College Organic Chemistry
Which of the following statements accurately describes condensation polymerization?
  1. joining monomers by means of decomposition
  2. joining monomers by means of double displacement
  3. joining monomers by means of substitution
  4. joining monomers by dehydration synthesis
College Organic Chemistry
Given the organic compound below, how could a geometric isomer be created?
Formula - Trans Butene
  1. Switch one of the methyl groups with a hydrogen atom on the other side
  2. Switch one of the methyl groups with a hydrogen atom on the same side
  3. Perform a hydrogenation reaction
  4. Perform a polymerization reaction
College Organic Chemistry
What is the name of the compound shown below?
Formula - Trans Butene
  1. trans-2-pentene
  2. trans-1-butene
  3. trans-2-butene
  4. trans-1-propene
College Organic Chemistry
College Organic Chemistry
College Organic Chemistry
A triglyceride is:
  1. The second most abundant lipid and the least concentrated source of energy
  2. The most abundant lipid and the least concentrated source of energy
  3. The most abundant lipid and the most concentrated source of energy
  4. The second most abundant lipid and the most concentrated source of energy
Previous Page 1 of 3 Next
You need to have at least 5 reputation to vote a question down. Learn How To Earn Badges.