Want to see correct answers?
Login or join for free!

Search Results for ch - All Grades

53 questions match "ch". Refine Your Search

87 categories match your search criteria.

Select questions to add to a test using the checkbox above each question. Remember to click the add selected questions to a test button before moving to another page.

Previous Page 1 of 3 Next
Grade 12 Organic Chemistry
What is the product of the following chemical reaction?

[math]CH_2=CH_2 + HBr rarr[/math]
  1. [math]CH_3-CH_2-Br[/math]
  2. [math]CH_3-CH=CH-Br[/math]
  3. [math]CH_2=CH-Br[/math]
  4. [math]CH_3-CH=CH-CH_2-Br[/math]
College Organic Chemistry
The notation 18:3 Delta 9, 12,15 represents:
  1. CH3-(CH2)7-(CH=CH-CH2)3-COOH
  2. CH3-(CH2)7-CH=CH-(CH2)7-COOH
  3. Ch3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7-COOH
  4. CH3-(CH2-CH=CH)3-(CH2)7-COOH
Kindergarten Consonants and Blends CCSS: RF.K.2

This question is a part of a group with common instructions. View group »

Grade 12 Organic Chemistry
Which of the following chemical formulas correctly represents a molecule of 1-propyne?
  1. [math] CH_3 CH_2 CH_3 [/math]
  2. [math] CH C CH_3 [/math]
  3. [math] CH_2 CH CH_3 [/math]
  4. [math] CHCH [/math]
Grade 2 Phonics
Grade 9 Periodic Table and Elements
Grade 12 Organic Chemistry
Grade 12 Organic Chemistry
What would be the IUPAC name of the following compound?

[math]CH-=C-CH_2-C-=CH[/math]
  1. Pent-2,4-diyne
  2. Pent-1,4-diyne
  3. Pent-1,3-diyne
  4. Pent-1,2-diyne
Grade 12 Organic Chemistry
Complete the following chemical reaction:

[math]H - C -= C - H + Cl_2 rarr[/math]
  1. [math]Cl-CH-CH-Cl[/math]
  2. [math]Cl-CH_2-CH_2-Cl[/math]
  3. [math]Cl-C-=C-Cl[/math]
  4. [math](Cl)_2-CH_2[/math]
Grade 11 Vectors CCSS: HSN-VM.A.2

This question is a part of a group with common instructions. View group »

What are the components of [math]vec{CH} ?[/math]
  1. [math]<<-4,0>>[/math]
  2. [math]<<4,0>>[/math]
  3. [math]<<-4,1>>[/math]
  4. [math]<<-4,4>>[/math]
Grade 2 Consonants and Blends
Which word contains the blend 'ch'?
  1. Cat
  2. Carry
  3. Chimpanzee
  4. Create
Grade 2 Phonics
Which word contains the CH digraph?
  1. Skirt
  2. Shirt
  3. Thick
  4. Chick
Previous Page 1 of 3 Next
You need to have at least 5 reputation to vote a question down. Learn How To Earn Badges.